C19H20ClN3O2 — CID 43970488
1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(3,4-dimethylphenyl)urea (PubChem CID 43970488) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 43970488 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-5-oxopyrrolidin-3-yl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CC(=O)N(c3ccc(Cl)cc3)C2)cc1C |
| InChI | InChI=1S/C19H20ClN3O2/c1-12-3-6-15(9-13(12)2)21-19(25)22-16-10-18(24)23(11-16)17-7-4-14(20)5-8-17/h3-9,16H,10-11H2,1-2H3,(H2,21,22,25) |
| InChIKey | KTEKAELQTRLCFI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |