C21H19N3O5 — CID 43971017
2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide (PubChem CID 43971017) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 43971017 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[1-(4-methoxyphenyl)-5-oxopyrrolidin-3-yl]acetamide |
| SMILES | COc1ccc(N2CC(NC(=O)CN3C(=O)c4ccccc4C3=O)CC2=O)cc1 |
| InChI | InChI=1S/C21H19N3O5/c1-29-15-8-6-14(7-9-15)23-11-13(10-19(23)26)22-18(25)12-24-20(27)16-4-2-3-5-17(16)21(24)28/h2-9,13H,10-12H2,1H3,(H,22,25) |
| InChIKey | NRIWWOPSRFWVJH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|