C16H12FN3O2 — CID 43971804
N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3-methylbenzamide (PubChem CID 43971804) has the molecular formula C16H12FN3O2 and a molecular weight of 297.29 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3-methylbenzamide.
| Compound Name | N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 43971804 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(-c3cccc(F)c3)o2)c1 |
| InChI | InChI=1S/C16H12FN3O2/c1-10-4-2-5-11(8-10)14(21)18-16-20-19-15(22-16)12-6-3-7-13(17)9-12/h2-9H,1H3,(H,18,20,21) |
| InChIKey | UDZSEZUYGADCNF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |