C20H14FN3O2 — CID 43971985
N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-2-naphthalen-2-ylacetamide (PubChem CID 43971985) has the molecular formula C20H14FN3O2 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 43971985 |
| Molecular Formula | C20H14FN3O2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1nnc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C20H14FN3O2/c21-17-7-3-6-16(12-17)19-23-24-20(26-19)22-18(25)11-13-8-9-14-4-1-2-5-15(14)10-13/h1-10,12H,11H2,(H,22,24,25) |
| InChIKey | QUOPNGCKLZYTSR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |