C22H24ClN3O4S2 — CID 43974931
4-(4-chlorophenyl)sulfanyl-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]butanamide (PubChem CID 43974931) has the molecular formula C22H24ClN3O4S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 43974931 |
| Molecular Formula | C22H24ClN3O4S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[5-[(4-propan-2-ylsulfonylphenyl)methyl]-1,3,4-oxadiazol-2-yl]butanamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(Cc2nnc(NC(=O)CCCSc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C22H24ClN3O4S2/c1-15(2)32(28,29)19-11-5-16(6-12-19)14-21-25-26-22(30-21)24-20(27)4-3-13-31-18-9-7-17(23)8-10-18/h5-12,15H,3-4,13-14H2,1-2H3,(H,24,26,27) |
| InChIKey | UJBKSULFMIBPCA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|