C20H18Cl2N4O4S — CID 43976412
N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 43976412) has the molecular formula C20H18Cl2N4O4S and a molecular weight of 481.36 g/mol. Its IUPAC name is N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43976412 |
| Molecular Formula | C20H18Cl2N4O4S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | N-[5-(3,5-dichlorophenyl)-1,3,4-oxadiazol-2-yl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1nnc(-c2cc(Cl)cc(Cl)c2)o1)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H18Cl2N4O4S/c21-15-10-14(11-16(22)12-15)19-24-25-20(30-19)23-18(27)13-4-6-17(7-5-13)31(28,29)26-8-2-1-3-9-26/h4-7,10-12H,1-3,8-9H2,(H,23,25,27) |
| InChIKey | OIKCUUIABKFKQG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |