C17H13Cl2N3O2 — CID 43976885
3,5-dichloro-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 43976885) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43976885 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 3,5-dichloro-N-[5-(3,5-dimethylphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | Cc1cc(C)cc(-c2nnc(NC(=O)c3cc(Cl)cc(Cl)c3)o2)c1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c1-9-3-10(2)5-12(4-9)16-21-22-17(24-16)20-15(23)11-6-13(18)8-14(19)7-11/h3-8H,1-2H3,(H,20,22,23) |
| InChIKey | IBOLXFILJKMKRQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |