C20H23N3O4S — CID 43977266
N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]adamantane-1-carboxamide (PubChem CID 43977266) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 43977266 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[5-(3-methylsulfonylphenyl)-1,3,4-oxadiazol-2-yl]adamantane-1-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(-c2nnc(NC(=O)C34CC5CC(CC(C5)C3)C4)o2)c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-28(25,26)16-4-2-3-15(8-16)17-22-23-19(27-17)21-18(24)20-9-12-5-13(10-20)7-14(6-12)11-20/h2-4,8,12-14H,5-7,9-11H2,1H3,(H,21,23,24) |
| InChIKey | BDFFZSWTRQCNTM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |