C18H15N5O4S — CID 43977519
4-cyano-N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 43977519) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-cyano-N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-cyano-N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 43977519 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 4-cyano-N-[5-[4-(dimethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2nnc(NC(=O)c3ccc(C#N)cc3)o2)cc1 |
| InChI | InChI=1S/C18H15N5O4S/c1-23(2)28(25,26)15-9-7-14(8-10-15)17-21-22-18(27-17)20-16(24)13-5-3-12(11-19)4-6-13/h3-10H,1-2H3,(H,20,22,24) |
| InChIKey | QZACLSYYYBOUNZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 129.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |