About N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide
N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 43980555) has the molecular formula C8H13N3O4S
and a molecular weight of 247.28 g/mol. Its IUPAC name is N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 43980555 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H13N3O4S/c1-3-11(4-2)16(14,15)6-5-9-8(13)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12,13) |
| InChIKey | ILWWKFGDSLMHJR-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (CID 43980555) is N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is CCN(CC)S(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The InChIKey is ILWWKFGDSLMHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O4S/c1-3-11(4-2)16(14,15)6-5-9-8(13)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12,13).
What are the key properties of N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide has a molecular weight of 247.28 g/mol, XLogP of -0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 43980555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).