About 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione
5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione (PubChem CID 43980567) has the molecular formula C8H11N3O4S
and a molecular weight of 245.26 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 43980567 |
| Molecular Formula | C8H11N3O4S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(S(=O)(=O)N2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O4S/c12-7-6(5-9-8(13)10-7)16(14,15)11-3-1-2-4-11/h5H,1-4H2,(H2,9,10,12,13) |
| InChIKey | CWWPFVASAULHAT-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione (CID 43980567) is 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione is O=c1[nH]cc(S(=O)(=O)N2CCCC2)c(=O)[nH]1.
What is the InChIKey of 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione?
The InChIKey is CWWPFVASAULHAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4S/c12-7-6(5-9-8(13)10-7)16(14,15)11-3-1-2-4-11/h5H,1-4H2,(H2,9,10,12,13).
What are the key properties of 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione?
5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione has a molecular weight of 245.26 g/mol, XLogP of -1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-1-ylsulfonyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 43980567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).