C19H19FN2OS — CID 43984141
N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)-2-fluorobenzamide (PubChem CID 43984141) has the molecular formula C19H19FN2OS and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)-2-fluorobenzamide.
| Compound Name | N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)-2-fluorobenzamide |
|---|---|
| PubChem CID | 43984141 |
| Molecular Formula | C19H19FN2OS |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(6-ethyl-3-propyl-1,3-benzothiazol-2-ylidene)-2-fluorobenzamide |
| SMILES | CCCn1/c(=N/C(=O)c2ccccc2F)sc2cc(CC)ccc21 |
| InChI | InChI=1S/C19H19FN2OS/c1-3-11-22-16-10-9-13(4-2)12-17(16)24-19(22)21-18(23)14-7-5-6-8-15(14)20/h5-10,12H,3-4,11H2,1-2H3/b21-19- |
| InChIKey | PHHTXGIAKTVPTJ-VZCXRCSSSA-N |
| XLogP | 4.56 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |