C24H19FN2O2S — CID 43984866
4-benzoyl-N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43984866) has the molecular formula C24H19FN2O2S and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-benzoyl-N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-benzoyl-N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43984866 |
| Molecular Formula | C24H19FN2O2S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-benzoyl-N-(6-fluoro-3-propyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | CCCn1/c(=N/C(=O)c2ccc(C(=O)c3ccccc3)cc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C24H19FN2O2S/c1-2-14-27-20-13-12-19(25)15-21(20)30-24(27)26-23(29)18-10-8-17(9-11-18)22(28)16-6-4-3-5-7-16/h3-13,15H,2,14H2,1H3/b26-24- |
| InChIKey | JHOOPIGAYZGRIO-LCUIJRPUSA-N |
| XLogP | 5.22 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |