C26H25N3O4S — CID 43986614
(E)-3-(3,4-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 43986614) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43986614 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | CCOc1ccc2nc(N(Cc3ccccn3)C(=O)/C=C/c3ccc(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C26H25N3O4S/c1-4-33-20-10-11-21-24(16-20)34-26(28-21)29(17-19-7-5-6-14-27-19)25(30)13-9-18-8-12-22(31-2)23(15-18)32-3/h5-16H,4,17H2,1-3H3/b13-9+ |
| InChIKey | VAENGZWETXYVER-UKTHLTGXSA-N |
| XLogP | 5.35 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|