C27H26N4O4S2 — CID 43987830
4-[bis(prop-2-enyl)sulfamoyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 43987830) has the molecular formula C27H26N4O4S2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43987830 |
| Molecular Formula | C27H26N4O4S2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(5-methoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N(Cc2ccccn2)c2nc3cc(OC)ccc3s2)cc1 |
| InChI | InChI=1S/C27H26N4O4S2/c1-4-16-30(17-5-2)37(33,34)23-12-9-20(10-13-23)26(32)31(19-21-8-6-7-15-28-21)27-29-24-18-22(35-3)11-14-25(24)36-27/h4-15,18H,1-2,16-17,19H2,3H3 |
| InChIKey | CBNXRWPNMBUBND-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|