About N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide
N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 43990025) has the molecular formula C19H14F6N2OS
and a molecular weight of 432.39 g/mol. Its IUPAC name is N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide |
| PubChem CID | 43990025 |
| Molecular Formula | C19H14F6N2OS |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)c1cccc2sc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C19H14F6N2OS/c1-9(2)13-4-3-5-14-15(13)26-17(29-14)27-16(28)10-6-11(18(20,21)22)8-12(7-10)19(23,24)25/h3-9H,1-2H3,(H,26,27,28) |
| InChIKey | VEKFCIIFEPPMRP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide?
The IUPAC name of N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide (CID 43990025) is N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide.
What is the SMILES notation for N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide?
The canonical SMILES for N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide is CC(C)c1cccc2sc(NC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc12.
What is the InChIKey of N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide?
The InChIKey is VEKFCIIFEPPMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F6N2OS/c1-9(2)13-4-3-5-14-15(13)26-17(29-14)27-16(28)10-6-11(18(20,21)22)8-12(7-10)19(23,24)25/h3-9H,1-2H3,(H,26,27,28).
What are the key properties of N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide?
N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide has a molecular weight of 432.39 g/mol, XLogP of 6.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide is sourced from PubChem (CID 43990025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).