C26H27N3O4S — CID 43990420
N'-(2,6-dimethylphenyl)-N-[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]oxamide (PubChem CID 43990420) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]oxamide.
| Compound Name | N'-(2,6-dimethylphenyl)-N-[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]oxamide |
|---|---|
| PubChem CID | 43990420 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-[1-(4-methylphenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]oxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCc3ccc(NC(=O)C(=O)Nc4c(C)cccc4C)cc32)cc1 |
| InChI | InChI=1S/C26H27N3O4S/c1-17-9-13-22(14-10-17)34(32,33)29-15-5-8-20-11-12-21(16-23(20)29)27-25(30)26(31)28-24-18(2)6-4-7-19(24)3/h4,6-7,9-14,16H,5,8,15H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | WEGMQBWRIKYUIC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|