C25H27N5O3 — CID 43991753
2-(4-acetamidophenoxy)-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide (PubChem CID 43991753) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-(4-acetamidophenoxy)-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide.
| Compound Name | 2-(4-acetamidophenoxy)-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 43991753 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-(4-acetamidophenoxy)-N-[3-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(=O)Nc2cccc(-c3ccc(N4CCCCC4)nn3)c2)cc1 |
| InChI | InChI=1S/C25H27N5O3/c1-18(31)26-20-8-10-22(11-9-20)33-17-25(32)27-21-7-5-6-19(16-21)23-12-13-24(29-28-23)30-14-3-2-4-15-30/h5-13,16H,2-4,14-15,17H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | GKKIJHWQQAKKBO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |