C24H23N5O2 — CID 43992610
2-(2-cyanophenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide (PubChem CID 43992610) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 43992610 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]acetamide |
| SMILES | N#Cc1ccccc1OCC(=O)Nc1ccc(-c2ccc(N3CCCCC3)nn2)cc1 |
| InChI | InChI=1S/C24H23N5O2/c25-16-19-6-2-3-7-22(19)31-17-24(30)26-20-10-8-18(9-11-20)21-12-13-23(28-27-21)29-14-4-1-5-15-29/h2-3,6-13H,1,4-5,14-15,17H2,(H,26,30) |
| InChIKey | VGWSMNARSLYLIJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |