C25H28N4O3 — CID 43992664
2-(4-methoxyphenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]propanamide (PubChem CID 43992664) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]propanamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 43992664 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[4-(6-piperidin-1-ylpyridazin-3-yl)phenyl]propanamide |
| SMILES | COc1ccc(OC(C)C(=O)Nc2ccc(-c3ccc(N4CCCCC4)nn3)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-18(32-22-12-10-21(31-2)11-13-22)25(30)26-20-8-6-19(7-9-20)23-14-15-24(28-27-23)29-16-4-3-5-17-29/h6-15,18H,3-5,16-17H2,1-2H3,(H,26,30) |
| InChIKey | JYDIYKVFMBHJKI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |