C22H23N5O6S — CID 43993725
ethyl 3-cyano-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 43993725) has the molecular formula C22H23N5O6S and a molecular weight of 485.52 g/mol. Its IUPAC name is ethyl 3-cyano-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | ethyl 3-cyano-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 43993725 |
| Molecular Formula | C22H23N5O6S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | ethyl 3-cyano-2-[(4-morpholin-4-yl-3-nitrobenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc(NC(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C22H23N5O6S/c1-2-33-22(29)26-6-5-15-16(12-23)21(34-19(15)13-26)24-20(28)14-3-4-17(18(11-14)27(30)31)25-7-9-32-10-8-25/h3-4,11H,2,5-10,13H2,1H3,(H,24,28) |
| InChIKey | WYEJXONTKOGCTK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|