C21H16N4O5S3 — CID 43993781
methyl 3-(1,3-benzothiazol-2-yl)-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 43993781) has the molecular formula C21H16N4O5S3 and a molecular weight of 500.58 g/mol. Its IUPAC name is methyl 3-(1,3-benzothiazol-2-yl)-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-(1,3-benzothiazol-2-yl)-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 43993781 |
| Molecular Formula | C21H16N4O5S3 |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | methyl 3-(1,3-benzothiazol-2-yl)-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | COC(=O)N1CCc2c(sc(NC(=O)c3ccc([N+](=O)[O-])s3)c2-c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C21H16N4O5S3/c1-30-21(27)24-9-8-11-15(10-24)33-20(23-18(26)14-6-7-16(31-14)25(28)29)17(11)19-22-12-4-2-3-5-13(12)32-19/h2-7H,8-10H2,1H3,(H,23,26) |
| InChIKey | UCUSSPIYPHMWKS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|