C21H15ClIN3O2S — CID 43995120
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-iodo-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43995120) has the molecular formula C21H15ClIN3O2S and a molecular weight of 535.79 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-iodo-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-iodo-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43995120 |
| Molecular Formula | C21H15ClIN3O2S |
| Molecular Weight | 535.79 g/mol |
| Exact Mass | 534.96 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-2-iodo-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1ccc(Cl)c2sc(N(Cc3cccnc3)C(=O)c3ccccc3I)nc12 |
| InChI | InChI=1S/C21H15ClIN3O2S/c1-28-17-9-8-15(22)19-18(17)25-21(29-19)26(12-13-5-4-10-24-11-13)20(27)14-6-2-3-7-16(14)23/h2-11H,12H2,1H3 |
| InChIKey | XYXUWZSXDPOOIG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.79 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|