C15H16N4O5 — CID 43996615
ethyl 2-[[2-oxo-2-[(4-oxo-3H-phthalazin-1-yl)methylamino]acetyl]amino]acetate (PubChem CID 43996615) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is ethyl 2-[[2-oxo-2-[(4-oxo-3H-phthalazin-1-yl)methylamino]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-oxo-2-[(4-oxo-3H-phthalazin-1-yl)methylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 43996615 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | ethyl 2-[[2-oxo-2-[(4-oxo-3H-phthalazin-1-yl)methylamino]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)NCc1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H16N4O5/c1-2-24-12(20)8-17-15(23)14(22)16-7-11-9-5-3-4-6-10(9)13(21)19-18-11/h3-6H,2,7-8H2,1H3,(H,16,22)(H,17,23)(H,19,21) |
| InChIKey | BNULRWUVOXERND-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|