C24H21ClFN3O — CID 44132174
1-[(4-chloro-2-fluorophenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide (PubChem CID 44132174) has the molecular formula C24H21ClFN3O and a molecular weight of 421.90 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 44132174 |
| Molecular Formula | C24H21ClFN3O |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-[(1R)-1-phenylpropyl]benzimidazole-5-carboxamide |
| SMILES | CC[C@H](C1=CC=CC=C1)NC(=O)C2=CC3=C(C=C2)N(C=N3)CC4=C(C=C(C=C4)Cl)F |
| InChI | InChI=1S/C24H21ClFN3O/c1-2-21(16-6-4-3-5-7-16)28-24(30)17-9-11-23-22(12-17)27-15-29(23)14-18-8-10-19(25)13-20(18)26/h3-13,15,21H,2,14H2,1H3,(H,28,30)/t21-/m1/s1 |
| InChIKey | GFDMADAZGAOBRK-OAQYLSRUSA-N |
| XLogP | 5.50 |
| TPSA | 46.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | 573 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |