C33H41F3N4O4S — CID 44143271
Hydroxyethylamine derivative, 25 (PubChem CID 44143271) has the molecular formula C33H41F3N4O4S and a molecular weight of 646.80 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-5-(ethylamino)-N-[(2S,3R)-3-hydroxy-1-phenyl-4-[2-[3-(trifluoromethyl)phenyl]propan-2-ylamino]butan-2-yl]benzamide.
| Compound Name | Hydroxyethylamine derivative, 25 |
|---|---|
| PubChem CID | 44143271 |
| Molecular Formula | C33H41F3N4O4S |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.28 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-5-(ethylamino)-N-[(2S,3R)-3-hydroxy-1-phenyl-4-[2-[3-(trifluoromethyl)phenyl]propan-2-ylamino]butan-2-yl]benzamide |
| SMILES | CCNC1=CC(=CC(=C1)C(=O)N[C@@H](CC2=CC=CC=C2)[C@@H](CNC(C)(C)C3=CC(=CC=C3)C(F)(F)F)O)N4CCCCS4(=O)=O |
| InChI | InChI=1S/C33H41F3N4O4S/c1-4-37-27-18-24(19-28(21-27)40-15-8-9-16-45(40,43)44)31(42)39-29(17-23-11-6-5-7-12-23)30(41)22-38-32(2,3)25-13-10-14-26(20-25)33(34,35)36/h5-7,10-14,18-21,29-30,37-38,41H,4,8-9,15-17,22H2,1-3H3,(H,39,42)/t29-,30+/m0/s1 |
| InChIKey | LQKSXPXJHUCHMO-XZWHSSHBSA-N |
| XLogP | 5.10 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | 1050 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |