C26H36N2O5 — CID 44201784
N-benzyl-2-[(3R,5Z,14R)-2,11-dioxo-12-oxa-1-azabicyclo[12.3.0]heptadec-5-en-3-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 44201784) has the molecular formula C26H36N2O5 and a molecular weight of 456.60 g/mol. Its IUPAC name is N-benzyl-2-[(3R,5Z,14R)-2,11-dioxo-12-oxa-1-azabicyclo[12.3.0]heptadec-5-en-3-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(3R,5Z,14R)-2,11-dioxo-12-oxa-1-azabicyclo[12.3.0]heptadec-5-en-3-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 44201784 |
| Molecular Formula | C26H36N2O5 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N-benzyl-2-[(3R,5Z,14R)-2,11-dioxo-12-oxa-1-azabicyclo[12.3.0]heptadec-5-en-3-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C1CCC(=O)OC[C@H]2CCCN2C(=O)[C@H](C/C=C\C1)CC(=O)N(CCO)CC3=CC=CC=C3 |
| InChI | InChI=1S/C26H36N2O5/c29-17-16-27(19-21-10-5-4-6-11-21)24(30)18-22-12-7-2-1-3-8-14-25(31)33-20-23-13-9-15-28(23)26(22)32/h2,4-7,10-11,22-23,29H,1,3,8-9,12-20H2/b7-2-/t22-,23-/m1/s1 |
| InChIKey | NAZPLKTUINMPSO-UCUQLDKVSA-N |
| XLogP | 2.40 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | 674 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|