C28H30N2O — CID 44215411
1-Phenyl-2-[4-(3-piperidin-1-yl-propoxy)-phenyl]-indolizine (PubChem CID 44215411) has the molecular formula C28H30N2O and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-phenyl-2-[4-(3-piperidin-1-ylpropoxy)phenyl]indolizine.
| Compound Name | 1-Phenyl-2-[4-(3-piperidin-1-yl-propoxy)-phenyl]-indolizine |
|---|---|
| PubChem CID | 44215411 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 1-phenyl-2-[4-(3-piperidin-1-ylpropoxy)phenyl]indolizine |
| SMILES | C1CCN(CC1)CCCOC2=CC=C(C=C2)C3=CN4C=CC=CC4=C3C5=CC=CC=C5 |
| InChI | InChI=1S/C28H30N2O/c1-3-10-24(11-4-1)28-26(22-30-20-8-5-12-27(28)30)23-13-15-25(16-14-23)31-21-9-19-29-17-6-2-7-18-29/h1,3-5,8,10-16,20,22H,2,6-7,9,17-19,21H2 |
| InChIKey | GYWKLGRAFKRQNM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 16.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | 519 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|