About Val-Gly-Leu
Val-Gly-Leu (PubChem CID 44230565) has the molecular formula C13H25N3O4
and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | Val-Gly-Leu |
| PubChem CID | 44230565 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CNC(=O)[C@H](C(C)C)N |
| InChI | InChI=1S/C13H25N3O4/c1-7(2)5-9(13(19)20)16-10(17)6-15-12(18)11(14)8(3)4/h7-9,11H,5-6,14H2,1-4H3,(H,15,18)(H,16,17)(H,19,20)/t9-,11-/m0/s1 |
| InChIKey | URIRWLJVWHYLET-ONGXEEELSA-N |
| XLogP | -2.70 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | 356 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Val-Gly-Leu with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Val-Gly-Leu?
The IUPAC name of Val-Gly-Leu (CID 44230565) is (2S)-2-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]amino]-4-methylpentanoic acid.
What is the SMILES notation for Val-Gly-Leu?
The canonical SMILES for Val-Gly-Leu is CC(C)C[C@@H](C(=O)O)NC(=O)CNC(=O)[C@H](C(C)C)N.
What is the InChIKey of Val-Gly-Leu?
The InChIKey is URIRWLJVWHYLET-ONGXEEELSA-N. The full InChI is InChI=1S/C13H25N3O4/c1-7(2)5-9(13(19)20)16-10(17)6-15-12(18)11(14)8(3)4/h7-9,11H,5-6,14H2,1-4H3,(H,15,18)(H,16,17)(H,19,20)/t9-,11-/m0/s1.
What are the key properties of Val-Gly-Leu?
Val-Gly-Leu has a molecular weight of 287.36 g/mol, XLogP of -2.70, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Val-Gly-Leu is sourced from PubChem (CID 44230565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).