About Benzo[c][2,7]naphthyridine, 26
Benzo[c][2,7]naphthyridine, 26 (PubChem CID 44236923) has the molecular formula C25H20N4O2
and a molecular weight of 408.50 g/mol. Its IUPAC name is 9-methoxy-8-phenylmethoxy-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine.
Molecular Properties
| Compound Name | Benzo[c][2,7]naphthyridine, 26 |
| PubChem CID | 44236923 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 9-methoxy-8-phenylmethoxy-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COC1=C(C=C2C(=C1)C3=CC(=NC(=C3C=N2)N)C4=CN=CC=C4)OCC5=CC=CC=C5 |
| InChI | InChI=1S/C25H20N4O2/c1-30-23-11-19-18-10-21(17-8-5-9-27-13-17)29-25(26)20(18)14-28-22(19)12-24(23)31-15-16-6-3-2-4-7-16/h2-14H,15H2,1H3,(H2,26,29) |
| InChIKey | YCCPGMJTPHAWRA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | 572 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze Benzo[c][2,7]naphthyridine, 26 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzo[c][2,7]naphthyridine, 26?
The IUPAC name of Benzo[c][2,7]naphthyridine, 26 (CID 44236923) is 9-methoxy-8-phenylmethoxy-2-pyridin-3-ylbenzo[f][2,7]naphthyridin-4-amine.
What is the SMILES notation for Benzo[c][2,7]naphthyridine, 26?
The canonical SMILES for Benzo[c][2,7]naphthyridine, 26 is COC1=C(C=C2C(=C1)C3=CC(=NC(=C3C=N2)N)C4=CN=CC=C4)OCC5=CC=CC=C5.
What is the InChIKey of Benzo[c][2,7]naphthyridine, 26?
The InChIKey is YCCPGMJTPHAWRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N4O2/c1-30-23-11-19-18-10-21(17-8-5-9-27-13-17)29-25(26)20(18)14-28-22(19)12-24(23)31-15-16-6-3-2-4-7-16/h2-14H,15H2,1H3,(H2,26,29).
What are the key properties of Benzo[c][2,7]naphthyridine, 26?
Benzo[c][2,7]naphthyridine, 26 has a molecular weight of 408.50 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Benzo[c][2,7]naphthyridine, 26 is sourced from PubChem (CID 44236923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).