About Curdionolide B
Curdionolide B (PubChem CID 44254211) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is (6S,9E,11aR)-3,6,10-trimethyl-4,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,5-dione.
Molecular Properties
| Compound Name | Curdionolide B |
| PubChem CID | 44254211 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (6S,9E,11aR)-3,6,10-trimethyl-4,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,5-dione |
| SMILES | C[C@H]1CC/C=C(/C[C@@H]2C(=C(C(=O)O2)C)CC1=O)\C |
| InChI | InChI=1S/C15H20O3/c1-9-5-4-6-10(2)13(16)8-12-11(3)15(17)18-14(12)7-9/h5,10,14H,4,6-8H2,1-3H3/b9-5+/t10-,14+/m0/s1 |
| InChIKey | VILHAYBRKKWZBQ-SFWYFMFBSA-N |
| XLogP | 1.80 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | 443 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Curdionolide B with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Curdionolide B?
The IUPAC name of Curdionolide B (CID 44254211) is (6S,9E,11aR)-3,6,10-trimethyl-4,6,7,8,11,11a-hexahydrocyclodeca[b]furan-2,5-dione.
What is the SMILES notation for Curdionolide B?
The canonical SMILES for Curdionolide B is C[C@H]1CC/C=C(/C[C@@H]2C(=C(C(=O)O2)C)CC1=O)\C.
What is the InChIKey of Curdionolide B?
The InChIKey is VILHAYBRKKWZBQ-SFWYFMFBSA-N. The full InChI is InChI=1S/C15H20O3/c1-9-5-4-6-10(2)13(16)8-12-11(3)15(17)18-14(12)7-9/h5,10,14H,4,6-8H2,1-3H3/b9-5+/t10-,14+/m0/s1.
What are the key properties of Curdionolide B?
Curdionolide B has a molecular weight of 248.32 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Curdionolide B is sourced from PubChem (CID 44254211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).