About Australine
Australine (PubChem CID 442628) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is (1R,2R,3R,7S,8R)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol.
Molecular Properties
| Compound Name | Australine |
| PubChem CID | 442628 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (1R,2R,3R,7S,8R)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
| SMILES | C1CN2[C@@H]([C@H]([C@@H]([C@H]2[C@H]1O)O)O)CO |
| InChI | InChI=1S/C8H15NO4/c10-3-4-7(12)8(13)6-5(11)1-2-9(4)6/h4-8,10-13H,1-3H2/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | AIQMLBKBQCVDEY-OZRXBMAMSA-N |
| XLogP | -1.70 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 201 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Australine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Australine?
The IUPAC name of Australine (CID 442628) is (1R,2R,3R,7S,8R)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol.
What is the SMILES notation for Australine?
The canonical SMILES for Australine is C1CN2[C@@H]([C@H]([C@@H]([C@H]2[C@H]1O)O)O)CO.
What is the InChIKey of Australine?
The InChIKey is AIQMLBKBQCVDEY-OZRXBMAMSA-N. The full InChI is InChI=1S/C8H15NO4/c10-3-4-7(12)8(13)6-5(11)1-2-9(4)6/h4-8,10-13H,1-3H2/t4-,5+,6-,7-,8-/m1/s1.
What are the key properties of Australine?
Australine has a molecular weight of 189.21 g/mol, XLogP of -1.70, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Australine is sourced from PubChem (CID 442628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).