C22H31NO4 — CID 44269596
7-[(R)-2-((E)-3-Hydroxy-5-phenyl-pent-1-enyl)-5-oxo-pyrrolidin-1-yl]-heptanoic acid (PubChem CID 44269596) has the molecular formula C22H31NO4 and a molecular weight of 373.50 g/mol. Its IUPAC name is 7-[(2R)-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(R)-2-((E)-3-Hydroxy-5-phenyl-pent-1-enyl)-5-oxo-pyrrolidin-1-yl]-heptanoic acid |
|---|---|
| PubChem CID | 44269596 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 7-[(2R)-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]-5-oxopyrrolidin-1-yl]heptanoic acid |
| SMILES | C1CC(=O)N([C@H]1/C=C/C(CCC2=CC=CC=C2)O)CCCCCCC(=O)O |
| InChI | InChI=1S/C22H31NO4/c24-20(14-11-18-8-4-3-5-9-18)15-12-19-13-16-21(25)23(19)17-7-2-1-6-10-22(26)27/h3-5,8-9,12,15,19-20,24H,1-2,6-7,10-11,13-14,16-17H2,(H,26,27)/b15-12+/t19-,20?/m0/s1 |
| InChIKey | GDVRZKITCJWGMS-KWBANXLOSA-N |
| XLogP | 2.90 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | 485 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|