C29H41N3O3 — CID 44295536
1-(3-Acetyl-phenyl)-3-{3-[(2R,4S)-4-benzyl-2-((S)-1-hydroxy-pentyl)-piperidin-1-yl]-propyl}-urea (PubChem CID 44295536) has the molecular formula C29H41N3O3 and a molecular weight of 479.70 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3-[(2R,4S)-4-benzyl-2-[(1S)-1-hydroxypentyl]piperidin-1-yl]propyl]urea.
| Compound Name | 1-(3-Acetyl-phenyl)-3-{3-[(2R,4S)-4-benzyl-2-((S)-1-hydroxy-pentyl)-piperidin-1-yl]-propyl}-urea |
|---|---|
| PubChem CID | 44295536 |
| Molecular Formula | C29H41N3O3 |
| Molecular Weight | 479.70 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3-[(2R,4S)-4-benzyl-2-[(1S)-1-hydroxypentyl]piperidin-1-yl]propyl]urea |
| SMILES | CCCC[C@@H]([C@H]1C[C@H](CCN1CCCNC(=O)NC2=CC=CC(=C2)C(=O)C)CC3=CC=CC=C3)O |
| InChI | InChI=1S/C29H41N3O3/c1-3-4-14-28(34)27-20-24(19-23-10-6-5-7-11-23)15-18-32(27)17-9-16-30-29(35)31-26-13-8-12-25(21-26)22(2)33/h5-8,10-13,21,24,27-28,34H,3-4,9,14-20H2,1-2H3,(H2,30,31,35)/t24-,27-,28+/m1/s1 |
| InChIKey | UIBIFUUBDLVHTJ-RTVRTQBESA-N |
| XLogP | 4.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | 637 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|