About (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one
(12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one (PubChem CID 44302161) has the molecular formula C21H38O2
and a molecular weight of 322.50 g/mol. Its IUPAC name is (12Z,15Z)-1-hydroxyhenicosa-12,15-dien-4-one.
Molecular Properties
| Compound Name | (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one |
| PubChem CID | 44302161 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (12Z,15Z)-1-hydroxyhenicosa-12,15-dien-4-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)CCCO |
| InChI | InChI=1S/C21H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)19-17-20-22/h6-7,9-10,22H,2-5,8,11-20H2,1H3/b7-6-,10-9- |
| InChIKey | VOOONHBFXJHNHW-HZJYTTRNSA-N |
| XLogP | 6.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | 305 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one?
The IUPAC name of (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one (CID 44302161) is (12Z,15Z)-1-hydroxyhenicosa-12,15-dien-4-one.
What is the SMILES notation for (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one?
The canonical SMILES for (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one is CCCCC/C=C\C/C=C\CCCCCCCC(=O)CCCO.
What is the InChIKey of (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one?
The InChIKey is VOOONHBFXJHNHW-HZJYTTRNSA-N. The full InChI is InChI=1S/C21H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)19-17-20-22/h6-7,9-10,22H,2-5,8,11-20H2,1H3/b7-6-,10-9-.
What are the key properties of (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one?
(12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one has a molecular weight of 322.50 g/mol, XLogP of 6.30, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (12Z,15Z)-1-Hydroxy-henicosa-12,15-dien-4-one is sourced from PubChem (CID 44302161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).