About 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene
4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene (PubChem CID 44304974) has the molecular formula C9H11N3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
Analyze 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene?
The IUPAC name of 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene (CID 44304974) is 4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
What is the SMILES notation for 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene?
The canonical SMILES for 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene is C1CC2C3=CN=CN=C3CC1N2.
What is the InChIKey of 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene?
The InChIKey is OTYQMHKAYHPBDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-2-8-7-4-10-5-11-9(7)3-6(1)12-8/h4-6,8,12H,1-3H2.
What are the key properties of 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene?
4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene has a molecular weight of 161.20 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,12-Triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene is sourced from PubChem (CID 44304974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).