C30H50O — CID 44306333
2-Methyl-3-((7E,11E,15Z)-3,7,12,20-tetramethyl-16-vinyl-henicosa-7,11,15,19-tetraenyl)-oxirane (PubChem CID 44306333) has the molecular formula C30H50O and a molecular weight of 426.70 g/mol. Its IUPAC name is 2-[(7E,11E,15Z)-16-ethenyl-3,7,12,20-tetramethylhenicosa-7,11,15,19-tetraenyl]-3-methyloxirane.
| Compound Name | 2-Methyl-3-((7E,11E,15Z)-3,7,12,20-tetramethyl-16-vinyl-henicosa-7,11,15,19-tetraenyl)-oxirane |
|---|---|
| PubChem CID | 44306333 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 2-[(7E,11E,15Z)-16-ethenyl-3,7,12,20-tetramethylhenicosa-7,11,15,19-tetraenyl]-3-methyloxirane |
| SMILES | CC1C(O1)CCC(C)CCC/C(=C/CC/C=C(\C)/CC/C=C(/CCC=C(C)C)\C=C)/C |
| InChI | InChI=1S/C30H50O/c1-8-29(20-11-14-24(2)3)21-13-19-26(5)16-10-9-15-25(4)17-12-18-27(6)22-23-30-28(7)31-30/h8,14-16,21,27-28,30H,1,9-13,17-20,22-23H2,2-7H3/b25-15+,26-16+,29-21+ |
| InChIKey | SQNGRFWURHATRC-GROFMTQQSA-N |
| XLogP | 10.90 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | 627 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|