C11H17NO — CID 44310974
(NE)-N-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine (PubChem CID 44310974) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (NE)-N-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 44310974 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (NE)-N-[(4aS)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine |
| SMILES | C[C@@]12CCCCC1=C/C(=N/O)/CC2 |
| InChI | InChI=1S/C11H17NO/c1-11-6-3-2-4-9(11)8-10(12-13)5-7-11/h8,13H,2-7H2,1H3/b12-10+/t11-/m0/s1 |
| InChIKey | MTUSIFHFRNIWPP-OCUQMRJBSA-N |
| XLogP | 2.70 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | 267 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|