C20H25N3O — CID 44337352
N-(4-phenylbutyl)-1-phenylmethoxy-4,5-dihydroimidazol-2-amine (PubChem CID 44337352) has the molecular formula C20H25N3O and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(4-phenylbutyl)-1-phenylmethoxy-4,5-dihydroimidazol-2-amine.
| Compound Name | N-(4-phenylbutyl)-1-phenylmethoxy-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 44337352 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-(4-phenylbutyl)-1-phenylmethoxy-4,5-dihydroimidazol-2-amine |
| SMILES | C1CN(C(=N1)NCCCCC2=CC=CC=C2)OCC3=CC=CC=C3 |
| InChI | InChI=1S/C20H25N3O/c1-3-9-18(10-4-1)11-7-8-14-21-20-22-15-16-23(20)24-17-19-12-5-2-6-13-19/h1-6,9-10,12-13H,7-8,11,14-17H2,(H,21,22) |
| InChIKey | SVQYUMJGQQHRSA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 36.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | 373 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|