C19H25NO4S — CID 44340813
{Cyclopentyl-[2-(2,2-dimethyl-propionylsulfanyl)-benzoyl]-amino}-acetic acid (PubChem CID 44340813) has the molecular formula C19H25NO4S and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[cyclopentyl-[2-(2,2-dimethylpropanoylsulfanyl)benzoyl]amino]acetic acid.
| Compound Name | {Cyclopentyl-[2-(2,2-dimethyl-propionylsulfanyl)-benzoyl]-amino}-acetic acid |
|---|---|
| PubChem CID | 44340813 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-[cyclopentyl-[2-(2,2-dimethylpropanoylsulfanyl)benzoyl]amino]acetic acid |
| SMILES | CC(C)(C)C(=O)SC1=CC=CC=C1C(=O)N(CC(=O)O)C2CCCC2 |
| InChI | InChI=1S/C19H25NO4S/c1-19(2,3)18(24)25-15-11-7-6-10-14(15)17(23)20(12-16(21)22)13-8-4-5-9-13/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H,21,22) |
| InChIKey | CJQXQBCAPHJCBZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | 508 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|