C20H32N8O9S2 — CID 44341207
Ac-Cys(1)-Arg-Gly-Asp-Cys(1)-OH (PubChem CID 44341207) has the molecular formula C20H32N8O9S2 and a molecular weight of 592.70 g/mol. Its IUPAC name is (4R,7S,13S,16R)-16-acetamido-7-(carboxymethyl)-13-[3-(diaminomethylideneamino)propyl]-6,9,12,15-tetraoxo-1,2-dithia-5,8,11,14-tetrazacycloheptadecane-4-carboxylic acid.
| Compound Name | Ac-Cys(1)-Arg-Gly-Asp-Cys(1)-OH |
|---|---|
| PubChem CID | 44341207 |
| Molecular Formula | C20H32N8O9S2 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | (4R,7S,13S,16R)-16-acetamido-7-(carboxymethyl)-13-[3-(diaminomethylideneamino)propyl]-6,9,12,15-tetraoxo-1,2-dithia-5,8,11,14-tetrazacycloheptadecane-4-carboxylic acid |
| SMILES | CC(=O)N[C@H]1CSSC[C@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC1=O)CCCN=C(N)N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N8O9S2/c1-9(29)25-12-7-38-39-8-13(19(36)37)28-17(34)11(5-15(31)32)26-14(30)6-24-16(33)10(27-18(12)35)3-2-4-23-20(21)22/h10-13H,2-8H2,1H3,(H,24,33)(H,25,29)(H,26,30)(H,27,35)(H,28,34)(H,31,32)(H,36,37)(H4,21,22,23)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | HURPVXRLYUYEPQ-CYDGBPFRSA-N |
| XLogP | -4.20 |
| TPSA | 335.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | 977 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|