C15H19ClN2O3 — CID 44369476
Ethyl 3-(6-chloro-3-pyridinyl)-3-hydroxy-8-azabicyclo(3.2.1)octane-8-carboxylate (PubChem CID 44369476) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.77 g/mol. Its IUPAC name is ethyl 3-(6-chloro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | Ethyl 3-(6-chloro-3-pyridinyl)-3-hydroxy-8-azabicyclo(3.2.1)octane-8-carboxylate |
|---|---|
| PubChem CID | 44369476 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl 3-(6-chloro-3-pyridinyl)-3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCOC(=O)N1C2CCC1CC(C2)(C3=CN=C(C=C3)Cl)O |
| InChI | InChI=1S/C15H19ClN2O3/c1-2-21-14(19)18-11-4-5-12(18)8-15(20,7-11)10-3-6-13(16)17-9-10/h3,6,9,11-12,20H,2,4-5,7-8H2,1H3 |
| InChIKey | SLPRAMHKLMLDEH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 392 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|