About 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane
8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane (PubChem CID 44371953) has the molecular formula C29H29F2NO
and a molecular weight of 445.50 g/mol. Its IUPAC name is 8-benzyl-3-[2-[bis(4-fluorophenyl)methoxy]ethylidene]-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane |
| PubChem CID | 44371953 |
| Molecular Formula | C29H29F2NO |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 8-benzyl-3-[2-[bis(4-fluorophenyl)methoxy]ethylidene]-8-azabicyclo[3.2.1]octane |
| SMILES | C1CC2CC(=CCOC(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)CC1N2CC5=CC=CC=C5 |
| InChI | InChI=1S/C29H29F2NO/c30-25-10-6-23(7-11-25)29(24-8-12-26(31)13-9-24)33-17-16-22-18-27-14-15-28(19-22)32(27)20-21-4-2-1-3-5-21/h1-13,16,27-29H,14-15,17-20H2 |
| InChIKey | KYJSNZTVIGEASQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | 594 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane?
The IUPAC name of 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane (CID 44371953) is 8-benzyl-3-[2-[bis(4-fluorophenyl)methoxy]ethylidene]-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane?
The canonical SMILES for 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane is C1CC2CC(=CCOC(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)CC1N2CC5=CC=CC=C5.
What is the InChIKey of 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane?
The InChIKey is KYJSNZTVIGEASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H29F2NO/c30-25-10-6-23(7-11-25)29(24-8-12-26(31)13-9-24)33-17-16-22-18-27-14-15-28(19-22)32(27)20-21-4-2-1-3-5-21/h1-13,16,27-29H,14-15,17-20H2.
What are the key properties of 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane?
8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane has a molecular weight of 445.50 g/mol, XLogP of 6.10, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-Benzyl-3-{2-[bis-(4-fluoro-phenyl)-methoxy]-ethylidene}-8-aza-bicyclo[3.2.1]octane is sourced from PubChem (CID 44371953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).