C19H21NO4S — CID 44374458
(Z)-6-(4-Pyridin-3-yl-2-thiophen-2-yl-[1,3]dioxan-5-yl)-hex-4-enoic acid (PubChem CID 44374458) has the molecular formula C19H21NO4S and a molecular weight of 359.40 g/mol. Its IUPAC name is (Z)-6-(4-pyridin-3-yl-2-thiophen-2-yl-1,3-dioxan-5-yl)hex-4-enoic acid.
| Compound Name | (Z)-6-(4-Pyridin-3-yl-2-thiophen-2-yl-[1,3]dioxan-5-yl)-hex-4-enoic acid |
|---|---|
| PubChem CID | 44374458 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (Z)-6-(4-pyridin-3-yl-2-thiophen-2-yl-1,3-dioxan-5-yl)hex-4-enoic acid |
| SMILES | C1C(C(OC(O1)C2=CC=CS2)C3=CN=CC=C3)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C19H21NO4S/c21-17(22)9-3-1-2-6-15-13-23-19(16-8-5-11-25-16)24-18(15)14-7-4-10-20-12-14/h1-2,4-5,7-8,10-12,15,18-19H,3,6,9,13H2,(H,21,22)/b2-1- |
| InChIKey | TZGFTCJPPBRFFT-UPHRSURJSA-N |
| XLogP | 2.50 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | 459 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|