C10H8O9S3 — CID 4438
naphthalene-1,3,6-trisulfonic acid (PubChem CID 4438) has the molecular formula C10H8O9S3 and a molecular weight of 368.37 g/mol. Its IUPAC name is naphthalene-1,3,6-trisulfonic acid.
| Compound Name | naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 4438 |
| Molecular Formula | C10H8O9S3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | naphthalene-1,3,6-trisulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C10H8O9S3/c11-20(12,13)7-1-2-9-6(3-7)4-8(21(14,15)16)5-10(9)22(17,18)19/h1-5H,(H,11,12,13)(H,14,15,16)(H,17,18,19) |
| InChIKey | ZPBSAMLXSQCSOX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|