C36H60N4O5 — CID 44380918
(2S,4S,5S)-5-[[(2S)-2-[(2-acetamido-3-phenylpropanoyl)amino]hexanoyl]amino]-N-butyl-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanamide (PubChem CID 44380918) has the molecular formula C36H60N4O5 and a molecular weight of 628.90 g/mol. Its IUPAC name is (2S,4S,5S)-5-[[(2S)-2-[(2-acetamido-3-phenylpropanoyl)amino]hexanoyl]amino]-N-butyl-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanamide.
| Compound Name | (2S,4S,5S)-5-[[(2S)-2-[(2-acetamido-3-phenylpropanoyl)amino]hexanoyl]amino]-N-butyl-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 44380918 |
| Molecular Formula | C36H60N4O5 |
| Molecular Weight | 628.90 g/mol |
| Exact Mass | 628.46 |
| IUPAC Name | (2S,4S,5S)-5-[[(2S)-2-[(2-acetamido-3-phenylpropanoyl)amino]hexanoyl]amino]-N-butyl-6-cyclohexyl-4-hydroxy-2-propan-2-ylhexanamide |
| SMILES | CCCC[C@@H](C(=O)N[C@@H](CC1CCCCC1)[C@H](C[C@@H](C(C)C)C(=O)NCCCC)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)C |
| InChI | InChI=1S/C36H60N4O5/c1-6-8-20-30(39-36(45)32(38-26(5)41)23-28-18-14-11-15-19-28)35(44)40-31(22-27-16-12-10-13-17-27)33(42)24-29(25(3)4)34(43)37-21-9-7-2/h11,14-15,18-19,25,27,29-33,42H,6-10,12-13,16-17,20-24H2,1-5H3,(H,37,43)(H,38,41)(H,39,45)(H,40,44)/t29-,30-,31-,32?,33-/m0/s1 |
| InChIKey | IBLLBXKYLXOGGR-ORZIYQQOSA-N |
| XLogP | 6.80 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | 885 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.90 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|