About N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide
N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide (PubChem CID 44387158) has the molecular formula C16H13F2NO3S2
and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[6-(2,3-difluorophenyl)sulfanyl-1-oxo-2,3-dihydroinden-5-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide |
| PubChem CID | 44387158 |
| Molecular Formula | C16H13F2NO3S2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-[6-(2,3-difluorophenyl)sulfanyl-1-oxo-2,3-dihydroinden-5-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1=C(C=C2C(=C1)CCC2=O)SC3=CC=CC(=C3F)F |
| InChI | InChI=1S/C16H13F2NO3S2/c1-24(21,22)19-12-7-9-5-6-13(20)10(9)8-15(12)23-14-4-2-3-11(17)16(14)18/h2-4,7-8,19H,5-6H2,1H3 |
| InChIKey | FBWPNNUXDCEDTG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | 580 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide?
The IUPAC name of N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide (CID 44387158) is N-[6-(2,3-difluorophenyl)sulfanyl-1-oxo-2,3-dihydroinden-5-yl]methanesulfonamide.
What is the SMILES notation for N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide?
The canonical SMILES for N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide is CS(=O)(=O)NC1=C(C=C2C(=C1)CCC2=O)SC3=CC=CC(=C3F)F.
What is the InChIKey of N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide?
The InChIKey is FBWPNNUXDCEDTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NO3S2/c1-24(21,22)19-12-7-9-5-6-13(20)10(9)8-15(12)23-14-4-2-3-11(17)16(14)18/h2-4,7-8,19H,5-6H2,1H3.
What are the key properties of N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide?
N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide has a molecular weight of 369.40 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-Difluoro-phenylsulfanyl)-1-oxo-indan-5-yl]-methanesulfonamide is sourced from PubChem (CID 44387158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).