About RO 116 1148
RO 116 1148 (PubChem CID 44391713) has the molecular formula C19H28N2O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[(1-butylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
Molecular Properties
| Compound Name | RO 116 1148 |
| PubChem CID | 44391713 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[(1-butylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | CCCCN1CCC(CC1)CNC(=O)C2=C3C(=CC=C2)OCCO3 |
| InChI | InChI=1S/C19H28N2O3/c1-2-3-9-21-10-7-15(8-11-21)14-20-19(22)16-5-4-6-17-18(16)24-13-12-23-17/h4-6,15H,2-3,7-14H2,1H3,(H,20,22) |
| InChIKey | VBFBEYXWJLASJA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 396 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze RO 116 1148 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of RO 116 1148?
The IUPAC name of RO 116 1148 (CID 44391713) is N-[(1-butylpiperidin-4-yl)methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
What is the SMILES notation for RO 116 1148?
The canonical SMILES for RO 116 1148 is CCCCN1CCC(CC1)CNC(=O)C2=C3C(=CC=C2)OCCO3.
What is the InChIKey of RO 116 1148?
The InChIKey is VBFBEYXWJLASJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3/c1-2-3-9-21-10-7-15(8-11-21)14-20-19(22)16-5-4-6-17-18(16)24-13-12-23-17/h4-6,15H,2-3,7-14H2,1H3,(H,20,22).
What are the key properties of RO 116 1148?
RO 116 1148 has a molecular weight of 332.40 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for RO 116 1148 is sourced from PubChem (CID 44391713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).