About 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide
4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide (PubChem CID 44394272) has the molecular formula C19H14F3NO3S
and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-[3,4-difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide |
| PubChem CID | 44394272 |
| Molecular Formula | C19H14F3NO3S |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-[3,4-difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide |
| SMILES | COC1=C(C=C(C=C1)C2=C(C=CC(=C2F)F)C3=CC=C(C=C3)S(=O)(=O)N)F |
| InChI | InChI=1S/C19H14F3NO3S/c1-26-17-9-4-12(10-16(17)21)18-14(7-8-15(20)19(18)22)11-2-5-13(6-3-11)27(23,24)25/h2-10H,1H3,(H2,23,24,25) |
| InChIKey | VAVYTEMFUFRIBJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | 591 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide?
The IUPAC name of 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide (CID 44394272) is 4-[3,4-difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide.
What is the SMILES notation for 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide?
The canonical SMILES for 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide is COC1=C(C=C(C=C1)C2=C(C=CC(=C2F)F)C3=CC=C(C=C3)S(=O)(=O)N)F.
What is the InChIKey of 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide?
The InChIKey is VAVYTEMFUFRIBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3NO3S/c1-26-17-9-4-12(10-16(17)21)18-14(7-8-15(20)19(18)22)11-2-5-13(6-3-11)27(23,24)25/h2-10H,1H3,(H2,23,24,25).
What are the key properties of 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide?
4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide has a molecular weight of 393.40 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,4-Difluoro-2-(3-fluoro-4-methoxyphenyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 44394272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).