About Val-Ala-Leu
Val-Ala-Leu (PubChem CID 44398488) has the molecular formula C14H27N3O4
and a molecular weight of 301.38 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | Val-Ala-Leu |
| PubChem CID | 44398488 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoic acid |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](C(C)C)N |
| InChI | InChI=1S/C14H27N3O4/c1-7(2)6-10(14(20)21)17-12(18)9(5)16-13(19)11(15)8(3)4/h7-11H,6,15H2,1-5H3,(H,16,19)(H,17,18)(H,20,21)/t9-,10-,11-/m0/s1 |
| InChIKey | UXBZYLSMYOATLH-DCAQKATOSA-N |
| XLogP | -2.30 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | 382 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Val-Ala-Leu with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Val-Ala-Leu?
The IUPAC name of Val-Ala-Leu (CID 44398488) is (2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]propanoyl]amino]-4-methylpentanoic acid.
What is the SMILES notation for Val-Ala-Leu?
The canonical SMILES for Val-Ala-Leu is C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](C(C)C)N.
What is the InChIKey of Val-Ala-Leu?
The InChIKey is UXBZYLSMYOATLH-DCAQKATOSA-N. The full InChI is InChI=1S/C14H27N3O4/c1-7(2)6-10(14(20)21)17-12(18)9(5)16-13(19)11(15)8(3)4/h7-11H,6,15H2,1-5H3,(H,16,19)(H,17,18)(H,20,21)/t9-,10-,11-/m0/s1.
What are the key properties of Val-Ala-Leu?
Val-Ala-Leu has a molecular weight of 301.38 g/mol, XLogP of -2.30, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Val-Ala-Leu is sourced from PubChem (CID 44398488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).